About 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one
1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 39895131) has the molecular formula C15H23N5O
and a molecular weight of 289.38 g/mol. Its IUPAC name is 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 39895131 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCn1c(N2CCCCC2)nc2c(C)nn(C)c2c1=O |
| InChI | InChI=1S/C15H23N5O/c1-4-8-20-14(21)13-12(11(2)17-18(13)3)16-15(20)19-9-6-5-7-10-19/h4-10H2,1-3H3 |
| InChIKey | BBCUJNFMHOTFHJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one (CID 39895131) is 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one is CCCn1c(N2CCCCC2)nc2c(C)nn(C)c2c1=O.
What is the InChIKey of 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one?
The InChIKey is BBCUJNFMHOTFHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N5O/c1-4-8-20-14(21)13-12(11(2)17-18(13)3)16-15(20)19-9-6-5-7-10-19/h4-10H2,1-3H3.
What are the key properties of 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one?
1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one has a molecular weight of 289.38 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-piperidin-1-yl-6-propylpyrazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 39895131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).