C20H26ClN3O2 — CID 39896911
4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-cyclooctylbutanamide (PubChem CID 39896911) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-cyclooctylbutanamide.
| Compound Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-cyclooctylbutanamide |
|---|---|
| PubChem CID | 39896911 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N-cyclooctylbutanamide |
| SMILES | O=C(CCCc1nc(-c2ccc(Cl)cc2)no1)NC1CCCCCCC1 |
| InChI | InChI=1S/C20H26ClN3O2/c21-16-13-11-15(12-14-16)20-23-19(26-24-20)10-6-9-18(25)22-17-7-4-2-1-3-5-8-17/h11-14,17H,1-10H2,(H,22,25) |
| InChIKey | KPRSMFALHKYBSS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |