C19H17N3O3S — CID 39897529
2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 39897529) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 39897529 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | O=C(CN1c2cccc3cccc(c23)S1(=O)=O)NCCc1ccccn1 |
| InChI | InChI=1S/C19H17N3O3S/c23-18(21-12-10-15-7-1-2-11-20-15)13-22-16-8-3-5-14-6-4-9-17(19(14)16)26(22,24)25/h1-9,11H,10,12-13H2,(H,21,23) |
| InChIKey | JNCFUDRQZQEKBD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |