About 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene
4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene (PubChem CID 3990055) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene |
| PubChem CID | 3990055 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(C)(N=[N+]=[N-])c2ccccc2)cc1C |
| InChI | InChI=1S/C16H17N3/c1-12-9-10-15(11-13(12)2)16(3,18-19-17)14-7-5-4-6-8-14/h4-11H,1-3H3 |
| InChIKey | YMDWPNISGBBNHN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene?
The IUPAC name of 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene (CID 3990055) is 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene.
What is the SMILES notation for 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene?
The canonical SMILES for 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene is Cc1ccc(C(C)(N=[N+]=[N-])c2ccccc2)cc1C.
What is the InChIKey of 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene?
The InChIKey is YMDWPNISGBBNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3/c1-12-9-10-15(11-13(12)2)16(3,18-19-17)14-7-5-4-6-8-14/h4-11H,1-3H3.
What are the key properties of 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene?
4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene has a molecular weight of 251.33 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-azido-1-phenylethyl)-1,2-dimethylbenzene is sourced from PubChem (CID 3990055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).