C21H18N2OS — CID 39902704
4-[(1S,4S)-4-thiophen-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenol (PubChem CID 39902704) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is 4-[(1S,4S)-4-thiophen-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenol.
| Compound Name | 4-[(1S,4S)-4-thiophen-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenol |
|---|---|
| PubChem CID | 39902704 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-[(1S,4S)-4-thiophen-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenol |
| SMILES | Oc1ccc([C@@H]2NC[C@@H](c3cccs3)c3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C21H18N2OS/c24-14-9-7-13(8-10-14)20-21-19(15-4-1-2-5-17(15)23-21)16(12-22-20)18-6-3-11-25-18/h1-11,16,20,22-24H,12H2/t16-,20-/m0/s1 |
| InChIKey | VRGSDOREZIQCQX-JXFKEZNVSA-N |
| XLogP | 4.76 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|