About N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide
N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 39903772) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 39903772 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)NC1CCCCCC1 |
| InChI | InChI=1S/C11H18N4O/c16-11(7-15-9-12-8-13-15)14-10-5-3-1-2-4-6-10/h8-10H,1-7H2,(H,14,16) |
| InChIKey | YLVIFNFKSZVNPJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide (CID 39903772) is N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide is O=C(Cn1cncn1)NC1CCCCCC1.
What is the InChIKey of N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide?
The InChIKey is YLVIFNFKSZVNPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O/c16-11(7-15-9-12-8-13-15)14-10-5-3-1-2-4-6-10/h8-10H,1-7H2,(H,14,16).
What are the key properties of N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide?
N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide has a molecular weight of 222.29 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-2-(1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 39903772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).