C15H20N2O3S — CID 39905459
2-(5-methylfuran-2-yl)-N-(3-propan-2-yloxypropyl)-1,3-thiazole-4-carboxamide (PubChem CID 39905459) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-N-(3-propan-2-yloxypropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(5-methylfuran-2-yl)-N-(3-propan-2-yloxypropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 39905459 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-N-(3-propan-2-yloxypropyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(-c2nc(C(=O)NCCCOC(C)C)cs2)o1 |
| InChI | InChI=1S/C15H20N2O3S/c1-10(2)19-8-4-7-16-14(18)12-9-21-15(17-12)13-6-5-11(3)20-13/h5-6,9-10H,4,7-8H2,1-3H3,(H,16,18) |
| InChIKey | ZZFQZPKKIWRUKR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|