C23H20N2O7 — CID 3990734
[2-[(2-cyano-1-benzofuran-3-yl)amino]-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 3990734) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is [2-[(2-cyano-1-benzofuran-3-yl)amino]-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(2-cyano-1-benzofuran-3-yl)amino]-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3990734 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [2-[(2-cyano-1-benzofuran-3-yl)amino]-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC(=O)Nc2c(C#N)oc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N2O7/c1-28-17-10-14(11-18(29-2)23(17)30-3)8-9-21(27)31-13-20(26)25-22-15-6-4-5-7-16(15)32-19(22)12-24/h4-11H,13H2,1-3H3,(H,25,26) |
| InChIKey | YYENNXDWMUXIGY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|