About (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate
(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate (PubChem CID 39907685) has the molecular formula C15H10FNO2S2
and a molecular weight of 319.38 g/mol. Its IUPAC name is (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate.
Molecular Properties
| Compound Name | (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate |
| PubChem CID | 39907685 |
| Molecular Formula | C15H10FNO2S2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate |
| SMILES | O=C(OCc1csc(-c2cccs2)n1)c1cccc(F)c1 |
| InChI | InChI=1S/C15H10FNO2S2/c16-11-4-1-3-10(7-11)15(18)19-8-12-9-21-14(17-12)13-5-2-6-20-13/h1-7,9H,8H2 |
| InChIKey | QBSXIFDTECHKDS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate?
The IUPAC name of (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate (CID 39907685) is (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate.
What is the SMILES notation for (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate?
The canonical SMILES for (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate is O=C(OCc1csc(-c2cccs2)n1)c1cccc(F)c1.
What is the InChIKey of (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate?
The InChIKey is QBSXIFDTECHKDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FNO2S2/c16-11-4-1-3-10(7-11)15(18)19-8-12-9-21-14(17-12)13-5-2-6-20-13/h1-7,9H,8H2.
What are the key properties of (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate?
(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate has a molecular weight of 319.38 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-thiophen-2-yl-1,3-thiazol-4-yl)methyl 3-fluorobenzoate is sourced from PubChem (CID 39907685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).