C13H20F3N3O4 — CID 39909369
2,2,2-trifluoroethyl 4-[(2-methylpropanoylamino)carbamoyl]piperidine-1-carboxylate (PubChem CID 39909369) has the molecular formula C13H20F3N3O4 and a molecular weight of 339.31 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-[(2-methylpropanoylamino)carbamoyl]piperidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-[(2-methylpropanoylamino)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39909369 |
| Molecular Formula | C13H20F3N3O4 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-[(2-methylpropanoylamino)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)C(=O)NNC(=O)C1CCN(C(=O)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H20F3N3O4/c1-8(2)10(20)17-18-11(21)9-3-5-19(6-4-9)12(22)23-7-13(14,15)16/h8-9H,3-7H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | VIPCZRAIBXSMQT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|