C11H15F3NO2+ — CID 3991
trimethyl-[3-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]azanium (PubChem CID 3991) has the molecular formula C11H15F3NO2+ and a molecular weight of 250.24 g/mol. Its IUPAC name is trimethyl-[3-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]azanium.
| Compound Name | trimethyl-[3-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]azanium |
|---|---|
| PubChem CID | 3991 |
| Molecular Formula | C11H15F3NO2+ |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | trimethyl-[3-(2,2,2-trifluoro-1,1-dihydroxyethyl)phenyl]azanium |
| SMILES | C[N+](C)(C)c1cccc(C(O)(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3NO2/c1-15(2,3)9-6-4-5-8(7-9)10(16,17)11(12,13)14/h4-7,16-17H,1-3H3/q+1 |
| InChIKey | KGVDBJQLTHWAJF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|