C23H28N2O3S — CID 39911961
6-[[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]methyl]-2,3-dihydro-1H-inden-5-ol (PubChem CID 39911961) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 6-[[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]methyl]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 6-[[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]methyl]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 39911961 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 6-[[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]methyl]-2,3-dihydro-1H-inden-5-ol |
| SMILES | O=S(=O)(c1ccc2c(c1)CCC2)N1CCN(Cc2cc3c(cc2O)CCC3)CC1 |
| InChI | InChI=1S/C23H28N2O3S/c26-23-15-20-6-2-4-18(20)13-21(23)16-24-9-11-25(12-10-24)29(27,28)22-8-7-17-3-1-5-19(17)14-22/h7-8,13-15,26H,1-6,9-12,16H2 |
| InChIKey | UPVHLYJUJIFGIC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|