C15H19NO5S — CID 3991387
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2,4-dimethylbenzoate (PubChem CID 3991387) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2,4-dimethylbenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 3991387 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C15H19NO5S/c1-10-3-4-13(11(2)7-10)15(18)21-8-14(17)16-12-5-6-22(19,20)9-12/h3-4,7,12H,5-6,8-9H2,1-2H3,(H,16,17) |
| InChIKey | DQXHTYHZMDPPQG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |