C23H25F3N2O2 — CID 39915165
1-acetyl-N-methyl-4-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 39915165) has the molecular formula C23H25F3N2O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-acetyl-N-methyl-4-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-methyl-4-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39915165 |
| Molecular Formula | C23H25F3N2O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-acetyl-N-methyl-4-phenyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)N(C)Cc2ccc(C(F)(F)F)cc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25F3N2O2/c1-17(29)28-14-12-22(13-15-28,19-6-4-3-5-7-19)21(30)27(2)16-18-8-10-20(11-9-18)23(24,25)26/h3-11H,12-16H2,1-2H3 |
| InChIKey | JRTABZNSRHQQGZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |