C13H18N8O3S — CID 3991878
N-cyclopentyl-2-[[4-methyl-5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3991878) has the molecular formula C13H18N8O3S and a molecular weight of 366.41 g/mol. Its IUPAC name is N-cyclopentyl-2-[[4-methyl-5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopentyl-2-[[4-methyl-5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3991878 |
| Molecular Formula | C13H18N8O3S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-cyclopentyl-2-[[4-methyl-5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cn1c(Cn2cnc([N+](=O)[O-])n2)nnc1SCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C13H18N8O3S/c1-19-10(6-20-8-14-12(18-20)21(23)24)16-17-13(19)25-7-11(22)15-9-4-2-3-5-9/h8-9H,2-7H2,1H3,(H,15,22) |
| InChIKey | VCCMPFNBNCCGEJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|