C25H21N5O6S — CID 3992007
2-[1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-(4-nitrophenyl)sulfonylpropanehydrazide (PubChem CID 3992007) has the molecular formula C25H21N5O6S and a molecular weight of 519.54 g/mol. Its IUPAC name is 2-[1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-(4-nitrophenyl)sulfonylpropanehydrazide.
| Compound Name | 2-[1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-(4-nitrophenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 3992007 |
| Molecular Formula | C25H21N5O6S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 2-[1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-(4-nitrophenyl)sulfonylpropanehydrazide |
| SMILES | CC(C(=O)NNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H21N5O6S/c1-15(24(31)27-28-37(35,36)17-12-10-16(11-13-17)30(33)34)29-23(19-7-2-3-8-20(19)25(29)32)21-14-26-22-9-5-4-6-18(21)22/h2-15,23,26,28H,1H3,(H,27,31) |
| InChIKey | REULHUZKXNTUPV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|