C17H29NO2 — CID 3992440
1-(pentan-2-ylamino)-3-(2,3,6-trimethylphenoxy)propan-2-ol (PubChem CID 3992440) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-(pentan-2-ylamino)-3-(2,3,6-trimethylphenoxy)propan-2-ol.
| Compound Name | 1-(pentan-2-ylamino)-3-(2,3,6-trimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 3992440 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-(pentan-2-ylamino)-3-(2,3,6-trimethylphenoxy)propan-2-ol |
| SMILES | CCCC(C)NCC(O)COc1c(C)ccc(C)c1C |
| InChI | InChI=1S/C17H29NO2/c1-6-7-14(4)18-10-16(19)11-20-17-13(3)9-8-12(2)15(17)5/h8-9,14,16,18-19H,6-7,10-11H2,1-5H3 |
| InChIKey | VCUBYFRJFCTNDU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |