C14H12ClN5O2S3 — CID 39928786
2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 39928786) has the molecular formula C14H12ClN5O2S3 and a molecular weight of 413.94 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 39928786 |
| Molecular Formula | C14H12ClN5O2S3 |
| Molecular Weight | 413.94 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nnc(-c3cccc(Cl)c3)o2)s1 |
| InChI | InChI=1S/C14H12ClN5O2S3/c1-2-23-14-20-18-12(25-14)16-10(21)7-24-13-19-17-11(22-13)8-4-3-5-9(15)6-8/h3-6H,2,7H2,1H3,(H,16,18,21) |
| InChIKey | KOWWFUOJMAZWAP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|