C20H24N4O2 — CID 39929190
1,6-dimethyl-3-oxo-N-(4-pentylphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 39929190) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1,6-dimethyl-3-oxo-N-(4-pentylphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 1,6-dimethyl-3-oxo-N-(4-pentylphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 39929190 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1,6-dimethyl-3-oxo-N-(4-pentylphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CCCCCc1ccc(NC(=O)c2cc(C)nc3c2c(=O)[nH]n3C)cc1 |
| InChI | InChI=1S/C20H24N4O2/c1-4-5-6-7-14-8-10-15(11-9-14)22-19(25)16-12-13(2)21-18-17(16)20(26)23-24(18)3/h8-12H,4-7H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | SGDIKDOBASVCKN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|