C22H23F3N6O2 — CID 39941438
N'-[3-(dimethylamino)benzoyl]-5-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbohydrazide (PubChem CID 39941438) has the molecular formula C22H23F3N6O2 and a molecular weight of 460.46 g/mol. Its IUPAC name is N'-[3-(dimethylamino)benzoyl]-5-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbohydrazide.
| Compound Name | N'-[3-(dimethylamino)benzoyl]-5-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 39941438 |
| Molecular Formula | C22H23F3N6O2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N'-[3-(dimethylamino)benzoyl]-5-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbohydrazide |
| SMILES | CC(C)c1c(C(=O)NNC(=O)c2cccc(N(C)C)c2)cnn1-c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C22H23F3N6O2/c1-13(2)19-17(12-27-31(19)18-9-8-15(11-26-18)22(23,24)25)21(33)29-28-20(32)14-6-5-7-16(10-14)30(3)4/h5-13H,1-4H3,(H,28,32)(H,29,33) |
| InChIKey | AUFONAUSVFYKPL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|