C28H35N5O — CID 39942537
N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide (PubChem CID 39942537) has the molecular formula C28H35N5O and a molecular weight of 457.62 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide |
|---|---|
| PubChem CID | 39942537 |
| Molecular Formula | C28H35N5O |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-2-methylphenyl]-3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3nc(-c4ccccc4)n4c3CCCCC4)c(C)c2)CC1 |
| InChI | InChI=1S/C28H35N5O/c1-3-31-16-18-32(19-17-31)23-13-14-24(21(2)20-23)29-28(34)26-25-12-8-5-9-15-33(25)27(30-26)22-10-6-4-7-11-22/h4,6-7,10-11,13-14,20H,3,5,8-9,12,15-19H2,1-2H3,(H,29,34) |
| InChIKey | IPSIYDUJRFVQEF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|