About 3-methyl-1,4-dinitropyrazole
3-methyl-1,4-dinitropyrazole (PubChem CID 3994418) has the molecular formula C4H4N4O4
and a molecular weight of 172.10 g/mol. Its IUPAC name is 3-methyl-1,4-dinitropyrazole.
Molecular Properties
| Compound Name | 3-methyl-1,4-dinitropyrazole |
| PubChem CID | 3994418 |
| Molecular Formula | C4H4N4O4 |
| Molecular Weight | 172.10 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 3-methyl-1,4-dinitropyrazole |
| SMILES | Cc1nn([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C4H4N4O4/c1-3-4(7(9)10)2-6(5-3)8(11)12/h2H,1H3 |
| InChIKey | TZMOJNIVOCPMIA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.10 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,4-dinitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,4-dinitropyrazole?
The IUPAC name of 3-methyl-1,4-dinitropyrazole (CID 3994418) is 3-methyl-1,4-dinitropyrazole.
What is the SMILES notation for 3-methyl-1,4-dinitropyrazole?
The canonical SMILES for 3-methyl-1,4-dinitropyrazole is Cc1nn([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 3-methyl-1,4-dinitropyrazole?
The InChIKey is TZMOJNIVOCPMIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4O4/c1-3-4(7(9)10)2-6(5-3)8(11)12/h2H,1H3.
What are the key properties of 3-methyl-1,4-dinitropyrazole?
3-methyl-1,4-dinitropyrazole has a molecular weight of 172.10 g/mol, XLogP of 0.14, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,4-dinitropyrazole is sourced from PubChem (CID 3994418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).