About 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile
2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile (PubChem CID 3994419) has the molecular formula C16H14N4O
and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile |
| PubChem CID | 3994419 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile |
| SMILES | Cc1ccc(-c2c(C#N)c(N)n(C)c(=O)c2C#N)c(C)c1 |
| InChI | InChI=1S/C16H14N4O/c1-9-4-5-11(10(2)6-9)14-12(7-17)15(19)20(3)16(21)13(14)8-18/h4-6H,19H2,1-3H3 |
| InChIKey | RCMWHJFURDKSRD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile (CID 3994419) is 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile is Cc1ccc(-c2c(C#N)c(N)n(C)c(=O)c2C#N)c(C)c1.
What is the InChIKey of 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile?
The InChIKey is RCMWHJFURDKSRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O/c1-9-4-5-11(10(2)6-9)14-12(7-17)15(19)20(3)16(21)13(14)8-18/h4-6H,19H2,1-3H3.
What are the key properties of 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile?
2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile has a molecular weight of 278.31 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2,4-dimethylphenyl)-1-methyl-6-oxopyridine-3,5-dicarbonitrile is sourced from PubChem (CID 3994419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).