About N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide
N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide (PubChem CID 3994703) has the molecular formula C20H22N2O2S
and a molecular weight of 354.47 g/mol. Its IUPAC name is N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide |
| PubChem CID | 3994703 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)NCC1CCCO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2S/c23-19(22-20(25)21-14-17-12-7-13-24-17)18(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2,(H2,21,22,23,25) |
| InChIKey | HUECDTMZCZRBJS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide?
The IUPAC name of N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide (CID 3994703) is N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide.
What is the SMILES notation for N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide?
The canonical SMILES for N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide is O=C(NC(=S)NCC1CCCO1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide?
The InChIKey is HUECDTMZCZRBJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O2S/c23-19(22-20(25)21-14-17-12-7-13-24-17)18(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2,(H2,21,22,23,25).
What are the key properties of N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide?
N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide has a molecular weight of 354.47 g/mol, XLogP of 2.99, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethylcarbamothioyl)-2,2-diphenylacetamide is sourced from PubChem (CID 3994703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).