C17H21ClN4O2 — CID 39947953
3-(4-chlorophenyl)-N-[2-(diethylamino)-2-oxoethyl]-N-methyl-1H-pyrazole-5-carboxamide (PubChem CID 39947953) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-(diethylamino)-2-oxoethyl]-N-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-(diethylamino)-2-oxoethyl]-N-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 39947953 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-(diethylamino)-2-oxoethyl]-N-methyl-1H-pyrazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)c1cc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-4-22(5-2)16(23)11-21(3)17(24)15-10-14(19-20-15)12-6-8-13(18)9-7-12/h6-10H,4-5,11H2,1-3H3,(H,19,20) |
| InChIKey | XGHYGJIIXAOCDX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |