About N,N-diethyl-2,5-dimethylfuran-3-carboxamide
N,N-diethyl-2,5-dimethylfuran-3-carboxamide (PubChem CID 39949861) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is N,N-diethyl-2,5-dimethylfuran-3-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-2,5-dimethylfuran-3-carboxamide |
| PubChem CID | 39949861 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N,N-diethyl-2,5-dimethylfuran-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C11H17NO2/c1-5-12(6-2)11(13)10-7-8(3)14-9(10)4/h7H,5-6H2,1-4H3 |
| InChIKey | SIDOLLMOSSHQGR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethyl-2,5-dimethylfuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2,5-dimethylfuran-3-carboxamide?
The IUPAC name of N,N-diethyl-2,5-dimethylfuran-3-carboxamide (CID 39949861) is N,N-diethyl-2,5-dimethylfuran-3-carboxamide.
What is the SMILES notation for N,N-diethyl-2,5-dimethylfuran-3-carboxamide?
The canonical SMILES for N,N-diethyl-2,5-dimethylfuran-3-carboxamide is CCN(CC)C(=O)c1cc(C)oc1C.
What is the InChIKey of N,N-diethyl-2,5-dimethylfuran-3-carboxamide?
The InChIKey is SIDOLLMOSSHQGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-5-12(6-2)11(13)10-7-8(3)14-9(10)4/h7H,5-6H2,1-4H3.
What are the key properties of N,N-diethyl-2,5-dimethylfuran-3-carboxamide?
N,N-diethyl-2,5-dimethylfuran-3-carboxamide has a molecular weight of 195.26 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2,5-dimethylfuran-3-carboxamide is sourced from PubChem (CID 39949861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).