About 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol
3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol (PubChem CID 3995011) has the molecular formula C26H23N3O4
and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol.
Molecular Properties
| Compound Name | 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol |
| PubChem CID | 3995011 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol |
| SMILES | [H]/N=c1/c2c(ncn1Cc1ccccc1)Oc1cc(O)ccc1C2c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H23N3O4/c1-31-20-11-8-17(12-22(20)32-2)23-19-10-9-18(30)13-21(19)33-26-24(23)25(27)29(15-28-26)14-16-6-4-3-5-7-16/h3-13,15,23,27,30H,14H2,1-2H3/b27-25- |
| InChIKey | OLZRSSHGJOSZME-RFBIWTDZSA-N |
| XLogP | 4.42 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol?
The IUPAC name of 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol (CID 3995011) is 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol.
What is the SMILES notation for 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol?
The canonical SMILES for 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol is [H]/N=c1/c2c(ncn1Cc1ccccc1)Oc1cc(O)ccc1C2c1ccc(OC)c(OC)c1.
What is the InChIKey of 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol?
The InChIKey is OLZRSSHGJOSZME-RFBIWTDZSA-N. The full InChI is InChI=1S/C26H23N3O4/c1-31-20-11-8-17(12-22(20)32-2)23-19-10-9-18(30)13-21(19)33-26-24(23)25(27)29(15-28-26)14-16-6-4-3-5-7-16/h3-13,15,23,27,30H,14H2,1-2H3/b27-25-.
What are the key properties of 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol?
3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol has a molecular weight of 441.49 g/mol, XLogP of 4.42, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5-(3,4-dimethoxyphenyl)-4-imino-5H-chromeno[2,3-d]pyrimidin-8-ol is sourced from PubChem (CID 3995011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).