About 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol
1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol (PubChem CID 3995049) has the molecular formula C15H9Cl2N3O
and a molecular weight of 318.16 g/mol. Its IUPAC name is 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol |
| PubChem CID | 3995049 |
| Molecular Formula | C15H9Cl2N3O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1/N=N/c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl2N3O/c16-10-7-12(17)15(18-8-10)20-19-14-11-4-2-1-3-9(11)5-6-13(14)21/h1-8,21H/b20-19+ |
| InChIKey | LBGFLEHINUQYED-FMQUCBEESA-N |
| XLogP | 5.66 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol?
The IUPAC name of 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol (CID 3995049) is 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol.
What is the SMILES notation for 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol?
The canonical SMILES for 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol is Oc1ccc2ccccc2c1/N=N/c1ncc(Cl)cc1Cl.
What is the InChIKey of 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol?
The InChIKey is LBGFLEHINUQYED-FMQUCBEESA-N. The full InChI is InChI=1S/C15H9Cl2N3O/c16-10-7-12(17)15(18-8-10)20-19-14-11-4-2-1-3-9(11)5-6-13(14)21/h1-8,21H/b20-19+.
What are the key properties of 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol?
1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol has a molecular weight of 318.16 g/mol, XLogP of 5.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichloro-2-pyridinyl)diazenyl]naphthalen-2-ol is sourced from PubChem (CID 3995049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).