C21H21N3O — CID 39951575
(1S)-N-(7-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)cyclohex-3-ene-1-carboxamide (PubChem CID 39951575) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (1S)-N-(7-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-(7-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 39951575 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (1S)-N-(7-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1ccn2c(NC(=O)[C@@H]3CC=CCC3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C21H21N3O/c1-15-12-13-24-18(14-15)22-19(16-8-4-2-5-9-16)20(24)23-21(25)17-10-6-3-7-11-17/h2-6,8-9,12-14,17H,7,10-11H2,1H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | VHBVSDGJZDRGQJ-QGZVFWFLSA-N |
| XLogP | 4.60 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|