C21H21N3O3S — CID 39954455
(2R)-4-acetyl-N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 39954455) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is (2R)-4-acetyl-N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-4-acetyl-N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 39954455 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (2R)-4-acetyl-N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(=O)N1C[C@H](C(=O)Nc2sc3c(c2C#N)CC[C@@H](C)C3)Oc2ccccc21 |
| InChI | InChI=1S/C21H21N3O3S/c1-12-7-8-14-15(10-22)21(28-19(14)9-12)23-20(26)18-11-24(13(2)25)16-5-3-4-6-17(16)27-18/h3-6,12,18H,7-9,11H2,1-2H3,(H,23,26)/t12-,18-/m1/s1 |
| InChIKey | POBMEFRYZIVZAZ-KZULUSFZSA-N |
| XLogP | 3.50 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |