C20H29NO11 — CID 3996244
(2,3,4,5-tetraacetyloxy-6-oxo-6-pyrrolidin-1-ylhexyl) acetate (PubChem CID 3996244) has the molecular formula C20H29NO11 and a molecular weight of 459.45 g/mol. Its IUPAC name is (2,3,4,5-tetraacetyloxy-6-oxo-6-pyrrolidin-1-ylhexyl) acetate.
| Compound Name | (2,3,4,5-tetraacetyloxy-6-oxo-6-pyrrolidin-1-ylhexyl) acetate |
|---|---|
| PubChem CID | 3996244 |
| Molecular Formula | C20H29NO11 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (2,3,4,5-tetraacetyloxy-6-oxo-6-pyrrolidin-1-ylhexyl) acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C20H29NO11/c1-11(22)28-10-16(29-12(2)23)17(30-13(3)24)18(31-14(4)25)19(32-15(5)26)20(27)21-8-6-7-9-21/h16-19H,6-10H2,1-5H3 |
| InChIKey | BOEKMTCJKSJPOF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|