C24H33N3O3 — CID 39963411
N-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(3,4-dimethoxyphenyl)propanamide (PubChem CID 39963411) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 39963411 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-3-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCN2CCN(Cc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C24H33N3O3/c1-29-22-10-8-20(18-23(22)30-2)9-11-24(28)25-12-13-26-14-16-27(17-15-26)19-21-6-4-3-5-7-21/h3-8,10,18H,9,11-17,19H2,1-2H3,(H,25,28) |
| InChIKey | CILJZYWIZKJPEI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |