About 3-nitronaphthalene-1,2-diol
3-nitronaphthalene-1,2-diol (PubChem CID 3996428) has the molecular formula C10H7NO4
and a molecular weight of 205.17 g/mol. Its IUPAC name is 3-nitronaphthalene-1,2-diol.
Molecular Properties
| Compound Name | 3-nitronaphthalene-1,2-diol |
| PubChem CID | 3996428 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 3-nitronaphthalene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc2ccccc2c(O)c1O |
| InChI | InChI=1S/C10H7NO4/c12-9-7-4-2-1-3-6(7)5-8(10(9)13)11(14)15/h1-5,12-13H |
| InChIKey | MAPFDDLIANARRO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitronaphthalene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitronaphthalene-1,2-diol?
The IUPAC name of 3-nitronaphthalene-1,2-diol (CID 3996428) is 3-nitronaphthalene-1,2-diol.
What is the SMILES notation for 3-nitronaphthalene-1,2-diol?
The canonical SMILES for 3-nitronaphthalene-1,2-diol is O=[N+]([O-])c1cc2ccccc2c(O)c1O.
What is the InChIKey of 3-nitronaphthalene-1,2-diol?
The InChIKey is MAPFDDLIANARRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO4/c12-9-7-4-2-1-3-6(7)5-8(10(9)13)11(14)15/h1-5,12-13H.
What are the key properties of 3-nitronaphthalene-1,2-diol?
3-nitronaphthalene-1,2-diol has a molecular weight of 205.17 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitronaphthalene-1,2-diol is sourced from PubChem (CID 3996428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).