C19H16ClN3O6 — CID 39964401
N-(3-chloro-4-methoxyphenyl)-2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 39964401) has the molecular formula C19H16ClN3O6 and a molecular weight of 417.81 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 39964401 |
| Molecular Formula | C19H16ClN3O6 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[3-(4-methoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | COc1ccc(N2C(=O)C(=O)N(CC(=O)Nc3ccc(OC)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C19H16ClN3O6/c1-28-13-6-4-12(5-7-13)23-18(26)17(25)22(19(23)27)10-16(24)21-11-3-8-15(29-2)14(20)9-11/h3-9H,10H2,1-2H3,(H,21,24) |
| InChIKey | ZFHSOSJPQJHUAL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|