C21H21NO4S — CID 39965278
2-[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)butyl]isoindole-1,3-dione (PubChem CID 39965278) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 39965278 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfanyl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCSc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H21NO4S/c23-20-16-6-1-2-7-17(16)21(24)22(20)10-3-4-13-27-15-8-9-18-19(14-15)26-12-5-11-25-18/h1-2,6-9,14H,3-5,10-13H2 |
| InChIKey | KJQZAMCPTRQXMT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|