C26H21N5O3 — CID 39965493
3-(1,3-dioxoisoindol-2-yl)-N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide (PubChem CID 39965493) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 39965493 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-methyl-N-[(1S)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
| SMILES | C[C@@H](c1ccc(-n2cncn2)cc1)N(C)C(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C26H21N5O3/c1-17(18-10-12-20(13-11-18)30-16-27-15-28-30)29(2)24(32)19-6-5-7-21(14-19)31-25(33)22-8-3-4-9-23(22)26(31)34/h3-17H,1-2H3/t17-/m0/s1 |
| InChIKey | HZYGQJJKHLHVNE-KRWDZBQOSA-N |
| XLogP | 3.90 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|