C18H18FNO2 — CID 39965978
(1R)-1-(4-fluorophenyl)-N-[(7-methoxy-1-benzofuran-2-yl)methyl]ethanamine (PubChem CID 39965978) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is (1R)-1-(4-fluorophenyl)-N-[(7-methoxy-1-benzofuran-2-yl)methyl]ethanamine.
| Compound Name | (1R)-1-(4-fluorophenyl)-N-[(7-methoxy-1-benzofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 39965978 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (1R)-1-(4-fluorophenyl)-N-[(7-methoxy-1-benzofuran-2-yl)methyl]ethanamine |
| SMILES | COc1cccc2cc(CN[C@H](C)c3ccc(F)cc3)oc12 |
| InChI | InChI=1S/C18H18FNO2/c1-12(13-6-8-15(19)9-7-13)20-11-16-10-14-4-3-5-17(21-2)18(14)22-16/h3-10,12,20H,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | NCOMAPZVMMRGCZ-GFCCVEGCSA-N |
| XLogP | 4.43 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |