About 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate
1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 3996620) has the molecular formula C12H11N2O3-
and a molecular weight of 231.23 g/mol. Its IUPAC name is 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate.
Molecular Properties
| Compound Name | 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| PubChem CID | 3996620 |
| Molecular Formula | C12H11N2O3- |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCn1cc(C(=O)[O-])c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17)/p-1 |
| InChIKey | MHWLWQUZZRMNGJ-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate?
The IUPAC name of 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (CID 3996620) is 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate.
What is the SMILES notation for 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate?
The canonical SMILES for 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate is CCn1cc(C(=O)[O-])c(=O)c2ccc(C)nc21.
What is the InChIKey of 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate?
The InChIKey is MHWLWQUZZRMNGJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17)/p-1.
What are the key properties of 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate?
1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate has a molecular weight of 231.23 g/mol, XLogP of 0.09, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate is sourced from PubChem (CID 3996620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).