About 2-(benzotriazol-1-yl)-N,N-dimethylacetamide
2-(benzotriazol-1-yl)-N,N-dimethylacetamide (PubChem CID 39967035) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(benzotriazol-1-yl)-N,N-dimethylacetamide |
| PubChem CID | 39967035 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C10H12N4O/c1-13(2)10(15)7-14-9-6-4-3-5-8(9)11-12-14/h3-6H,7H2,1-2H3 |
| InChIKey | GLFVJFHTWGBMQX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzotriazol-1-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-1-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(benzotriazol-1-yl)-N,N-dimethylacetamide (CID 39967035) is 2-(benzotriazol-1-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(benzotriazol-1-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(benzotriazol-1-yl)-N,N-dimethylacetamide is CN(C)C(=O)Cn1nnc2ccccc21.
What is the InChIKey of 2-(benzotriazol-1-yl)-N,N-dimethylacetamide?
The InChIKey is GLFVJFHTWGBMQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-13(2)10(15)7-14-9-6-4-3-5-8(9)11-12-14/h3-6H,7H2,1-2H3.
What are the key properties of 2-(benzotriazol-1-yl)-N,N-dimethylacetamide?
2-(benzotriazol-1-yl)-N,N-dimethylacetamide has a molecular weight of 204.23 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-1-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 39967035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).