About [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate
[(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 39967363) has the molecular formula C14H13NO4S2
and a molecular weight of 323.40 g/mol. Its IUPAC name is [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
| PubChem CID | 39967363 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)O[C@H]1C[C@@H](C)OC1=O |
| InChI | InChI=1S/C14H13NO4S2/c1-7-6-9(13(16)18-7)19-14(17)11-8(2)15-12(21-11)10-4-3-5-20-10/h3-5,7,9H,6H2,1-2H3/t7-,9+/m1/s1 |
| InChIKey | ORFFXFJBPIBEAX-APPZFPTMSA-N |
| XLogP | 3.04 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate?
The IUPAC name of [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate (CID 39967363) is [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate?
The canonical SMILES for [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate is Cc1nc(-c2cccs2)sc1C(=O)O[C@H]1C[C@@H](C)OC1=O.
What is the InChIKey of [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate?
The InChIKey is ORFFXFJBPIBEAX-APPZFPTMSA-N. The full InChI is InChI=1S/C14H13NO4S2/c1-7-6-9(13(16)18-7)19-14(17)11-8(2)15-12(21-11)10-4-3-5-20-10/h3-5,7,9H,6H2,1-2H3/t7-,9+/m1/s1.
What are the key properties of [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate?
[(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate has a molecular weight of 323.40 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5R)-5-methyl-2-oxooxolan-3-yl] 4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 39967363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).