C22H23N3O3S — CID 39967725
4-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-(4-morpholin-4-ylphenyl)benzamide (PubChem CID 39967725) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-(4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-(4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 39967725 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-(4-morpholin-4-ylphenyl)benzamide |
| SMILES | Cc1nc(COc2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2)cs1 |
| InChI | InChI=1S/C22H23N3O3S/c1-16-23-19(15-29-16)14-28-21-8-2-17(3-9-21)22(26)24-18-4-6-20(7-5-18)25-10-12-27-13-11-25/h2-9,15H,10-14H2,1H3,(H,24,26) |
| InChIKey | AWURLBCJNTWNRB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|