C21H18N4O3S — CID 39968086
N'-[2-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 39968086) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 39968086 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cn1cccc1C(=O)NNC(=O)c1ccccc1CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C21H18N4O3S/c1-25-12-6-10-17(25)20(27)24-23-19(26)15-8-3-2-7-14(15)13-29-21-22-16-9-4-5-11-18(16)28-21/h2-12H,13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | YERVHSDGDDVVTB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|