C19H18N4O3 — CID 39968255
N-[(1R)-1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-2H-benzotriazole-5-carboxamide (PubChem CID 39968255) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[(1R)-1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[(1R)-1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 39968255 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[(1R)-1-(7-ethoxy-1-benzofuran-2-yl)ethyl]-2H-benzotriazole-5-carboxamide |
| SMILES | CCOc1cccc2cc([C@@H](C)NC(=O)c3ccc4n[nH]nc4c3)oc12 |
| InChI | InChI=1S/C19H18N4O3/c1-3-25-16-6-4-5-12-10-17(26-18(12)16)11(2)20-19(24)13-7-8-14-15(9-13)22-23-21-14/h4-11H,3H2,1-2H3,(H,20,24)(H,21,22,23)/t11-/m1/s1 |
| InChIKey | SASYPRBKBHKTOE-LLVKDONJSA-N |
| XLogP | 3.59 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |