C13H14N4O5 — CID 39969414
3-(2,5-dioxopyrrolidin-1-yl)-N'-(2-nitrophenyl)propanehydrazide (PubChem CID 39969414) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N'-(2-nitrophenyl)propanehydrazide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N'-(2-nitrophenyl)propanehydrazide |
|---|---|
| PubChem CID | 39969414 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N'-(2-nitrophenyl)propanehydrazide |
| SMILES | O=C(CCN1C(=O)CCC1=O)NNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N4O5/c18-11(7-8-16-12(19)5-6-13(16)20)15-14-9-3-1-2-4-10(9)17(21)22/h1-4,14H,5-8H2,(H,15,18) |
| InChIKey | CJYWADWDDLJFJC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|