C29H31FN4OS — CID 3997142
N-[[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide (PubChem CID 3997142) has the molecular formula C29H31FN4OS and a molecular weight of 502.66 g/mol. Its IUPAC name is N-[[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide.
| Compound Name | N-[[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 3997142 |
| Molecular Formula | C29H31FN4OS |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | N-[[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)NCc2nnc(SCc3ccc(F)cc3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H31FN4OS/c1-3-4-5-6-22-9-13-24(14-10-22)28(35)31-19-27-32-33-29(34(27)26-17-7-21(2)8-18-26)36-20-23-11-15-25(30)16-12-23/h7-18H,3-6,19-20H2,1-2H3,(H,31,35) |
| InChIKey | FOHSWWHHVAYHGM-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|