C19H19FN2O2S — CID 39972873
(2S)-1-(4-fluorophenoxy)-3-[1-(2-methylphenyl)imidazol-2-yl]sulfanylpropan-2-ol (PubChem CID 39972873) has the molecular formula C19H19FN2O2S and a molecular weight of 358.44 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenoxy)-3-[1-(2-methylphenyl)imidazol-2-yl]sulfanylpropan-2-ol.
| Compound Name | (2S)-1-(4-fluorophenoxy)-3-[1-(2-methylphenyl)imidazol-2-yl]sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 39972873 |
| Molecular Formula | C19H19FN2O2S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (2S)-1-(4-fluorophenoxy)-3-[1-(2-methylphenyl)imidazol-2-yl]sulfanylpropan-2-ol |
| SMILES | Cc1ccccc1-n1ccnc1SC[C@@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O2S/c1-14-4-2-3-5-18(14)22-11-10-21-19(22)25-13-16(23)12-24-17-8-6-15(20)7-9-17/h2-11,16,23H,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | NTLNTWYOMALMAU-INIZCTEOSA-N |
| XLogP | 3.85 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |