C15H22N2O — CID 39975112
N-(cyclohexylmethyl)-N,6-dimethylpyridine-3-carboxamide (PubChem CID 39975112) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-N,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 39975112 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-(cyclohexylmethyl)-N,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)CC2CCCCC2)cn1 |
| InChI | InChI=1S/C15H22N2O/c1-12-8-9-14(10-16-12)15(18)17(2)11-13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3 |
| InChIKey | PEWXAJJNYRRRJL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |