C18H22N2O4S — CID 39977224
1-(4-methylsulfonyl-1,4-diazepan-1-yl)-2-naphthalen-1-yloxyethanone (PubChem CID 39977224) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-(4-methylsulfonyl-1,4-diazepan-1-yl)-2-naphthalen-1-yloxyethanone.
| Compound Name | 1-(4-methylsulfonyl-1,4-diazepan-1-yl)-2-naphthalen-1-yloxyethanone |
|---|---|
| PubChem CID | 39977224 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(4-methylsulfonyl-1,4-diazepan-1-yl)-2-naphthalen-1-yloxyethanone |
| SMILES | CS(=O)(=O)N1CCCN(C(=O)COc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C18H22N2O4S/c1-25(22,23)20-11-5-10-19(12-13-20)18(21)14-24-17-9-4-7-15-6-2-3-8-16(15)17/h2-4,6-9H,5,10-14H2,1H3 |
| InChIKey | DIKIGSIMXWTDGI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |