C22H23FN2O2S — CID 39982559
N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-phenylbenzenesulfonamide (PubChem CID 39982559) has the molecular formula C22H23FN2O2S and a molecular weight of 398.50 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-phenylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 39982559 |
| Molecular Formula | C22H23FN2O2S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-phenylbenzenesulfonamide |
| SMILES | CN(C)[C@H](CNS(=O)(=O)c1ccccc1-c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H23FN2O2S/c1-25(2)21(18-11-8-12-19(23)15-18)16-24-28(26,27)22-14-7-6-13-20(22)17-9-4-3-5-10-17/h3-15,21,24H,16H2,1-2H3/t21-/m1/s1 |
| InChIKey | ZJJAWPOAZRTYHU-OAQYLSRUSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |