C20H24ClNO3S — CID 39991594
(2S)-1-[2-(4-chlorophenyl)sulfonylethyl]-2-(4-ethoxyphenyl)pyrrolidine (PubChem CID 39991594) has the molecular formula C20H24ClNO3S and a molecular weight of 393.94 g/mol. Its IUPAC name is (2S)-1-[2-(4-chlorophenyl)sulfonylethyl]-2-(4-ethoxyphenyl)pyrrolidine.
| Compound Name | (2S)-1-[2-(4-chlorophenyl)sulfonylethyl]-2-(4-ethoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 39991594 |
| Molecular Formula | C20H24ClNO3S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (2S)-1-[2-(4-chlorophenyl)sulfonylethyl]-2-(4-ethoxyphenyl)pyrrolidine |
| SMILES | CCOc1ccc([C@@H]2CCCN2CCS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H24ClNO3S/c1-2-25-18-9-5-16(6-10-18)20-4-3-13-22(20)14-15-26(23,24)19-11-7-17(21)8-12-19/h5-12,20H,2-4,13-15H2,1H3/t20-/m0/s1 |
| InChIKey | NEFFQWYVEIUJTI-FQEVSTJZSA-N |
| XLogP | 4.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |